C12H20N4O2 — CID 159083595
N'-(5-tert-butyl-1,3-oxazol-2-yl)morpholine-4-carboximidamide (PubChem CID 159083595) has the molecular formula C12H20N4O2 and a molecular weight of 252.32 g/mol. Its IUPAC name is N'-(5-tert-butyl-1,3-oxazol-2-yl)morpholine-4-carboximidamide.
| Compound Name | N'-(5-tert-butyl-1,3-oxazol-2-yl)morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 159083595 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | N'-(5-tert-butyl-1,3-oxazol-2-yl)morpholine-4-carboximidamide |
| SMILES | CC(C)(C)c1cnc(N=C(N)N2CCOCC2)o1 |
| InChI | InChI=1S/C12H20N4O2/c1-12(2,3)9-8-14-11(18-9)15-10(13)16-4-6-17-7-5-16/h8H,4-7H2,1-3H3,(H2,13,14,15) |
| InChIKey | DIJFXKYCYIEOMA-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|