C19H35NO3Si — CID 24749448
(6R,7S,7aS)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,3-dimethyl-6-prop-1-en-2-yl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 24749448) has the molecular formula C19H35NO3Si and a molecular weight of 353.58 g/mol. Its IUPAC name is (6R,7S,7aS)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,3-dimethyl-6-prop-1-en-2-yl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (6R,7S,7aS)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,3-dimethyl-6-prop-1-en-2-yl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 24749448 |
| Molecular Formula | C19H35NO3Si |
| Molecular Weight | 353.58 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | (6R,7S,7aS)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,3-dimethyl-6-prop-1-en-2-yl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | C=C(C)[C@@H]1C(=O)N2[C@H](COC2(C)C)[C@H]1CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H35NO3Si/c1-13(2)16-14(10-11-23-24(8,9)18(3,4)5)15-12-22-19(6,7)20(15)17(16)21/h14-16H,1,10-12H2,2-9H3/t14-,15-,16+/m1/s1 |
| InChIKey | RBQFFMLNYVITFB-OAGGEKHMSA-N |
| XLogP | 4.18 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.58 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|