C30H30O10S3 — CID 10818184
dimethyl 3,5-bis(benzenesulfonyl)-3-[1-(benzenesulfonyl)ethenyl]cyclohexane-1,1-dicarboxylate (PubChem CID 10818184) has the molecular formula C30H30O10S3 and a molecular weight of 646.76 g/mol. Its IUPAC name is dimethyl 3,5-bis(benzenesulfonyl)-3-[1-(benzenesulfonyl)ethenyl]cyclohexane-1,1-dicarboxylate.
| Compound Name | dimethyl 3,5-bis(benzenesulfonyl)-3-[1-(benzenesulfonyl)ethenyl]cyclohexane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10818184 |
| Molecular Formula | C30H30O10S3 |
| Molecular Weight | 646.76 g/mol |
| Exact Mass | 646.10 |
| IUPAC Name | dimethyl 3,5-bis(benzenesulfonyl)-3-[1-(benzenesulfonyl)ethenyl]cyclohexane-1,1-dicarboxylate |
| SMILES | C=C(C1(S(=O)(=O)c2ccccc2)CC(S(=O)(=O)c2ccccc2)CC(C(=O)OC)(C(=O)OC)C1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H30O10S3/c1-22(41(33,34)23-13-7-4-8-14-23)30(43(37,38)25-17-11-6-12-18-25)20-26(42(35,36)24-15-9-5-10-16-24)19-29(21-30,27(31)39-2)28(32)40-3/h4-18,26H,1,19-21H2,2-3H3 |
| InChIKey | YXBIJGOBGKTMPG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 155.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.76 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|