C26H42O4Si — CID 102481960
(3aS,4R,7aS)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-4-(4-methylpent-3-enyl)-7a-[(E)-3-oxobut-1-enyl]-3a,5-dihydro-3H-1-benzofuran-2-one (PubChem CID 102481960) has the molecular formula C26H42O4Si and a molecular weight of 446.70 g/mol. Its IUPAC name is (3aS,4R,7aS)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-4-(4-methylpent-3-enyl)-7a-[(E)-3-oxobut-1-enyl]-3a,5-dihydro-3H-1-benzofuran-2-one.
| Compound Name | (3aS,4R,7aS)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-4-(4-methylpent-3-enyl)-7a-[(E)-3-oxobut-1-enyl]-3a,5-dihydro-3H-1-benzofuran-2-one |
|---|---|
| PubChem CID | 102481960 |
| Molecular Formula | C26H42O4Si |
| Molecular Weight | 446.70 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | (3aS,4R,7aS)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-4-(4-methylpent-3-enyl)-7a-[(E)-3-oxobut-1-enyl]-3a,5-dihydro-3H-1-benzofuran-2-one |
| SMILES | CC(=O)/C=C/[C@]12OC(=O)C[C@H]1[C@](C)(CCC=C(C)C)CC=C2CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H42O4Si/c1-19(2)11-10-14-25(7)15-13-21(18-29-31(8,9)24(4,5)6)26(16-12-20(3)27)22(25)17-23(28)30-26/h11-13,16,22H,10,14-15,17-18H2,1-9H3/b16-12+/t22-,25+,26+/m0/s1 |
| InChIKey | ZZVTXLTZVPIXDD-KWOXFXHVSA-N |
| XLogP | 6.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.70 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|