C21H32O5Si — CID 91758439
(4R,6aS)-6a-[(3S,4E)-4-[1-[tert-butyl(dimethyl)silyl]oxyethylidene]-3-methyl-5-oxooxolan-3-yl]-4-methyl-5,6-dihydro-4H-cyclopenta[b]furan-2-one (PubChem CID 91758439) has the molecular formula C21H32O5Si and a molecular weight of 392.57 g/mol. Its IUPAC name is (4R,6aS)-6a-[(3S,4E)-4-[1-[tert-butyl(dimethyl)silyl]oxyethylidene]-3-methyl-5-oxooxolan-3-yl]-4-methyl-5,6-dihydro-4H-cyclopenta[b]furan-2-one.
| Compound Name | (4R,6aS)-6a-[(3S,4E)-4-[1-[tert-butyl(dimethyl)silyl]oxyethylidene]-3-methyl-5-oxooxolan-3-yl]-4-methyl-5,6-dihydro-4H-cyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 91758439 |
| Molecular Formula | C21H32O5Si |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | (4R,6aS)-6a-[(3S,4E)-4-[1-[tert-butyl(dimethyl)silyl]oxyethylidene]-3-methyl-5-oxooxolan-3-yl]-4-methyl-5,6-dihydro-4H-cyclopenta[b]furan-2-one |
| SMILES | C/C(O[Si](C)(C)C(C)(C)C)=C1\C(=O)OC[C@@]1(C)[C@]12CC[C@@H](C)C1=CC(=O)O2 |
| InChI | InChI=1S/C21H32O5Si/c1-13-9-10-21(15(13)11-16(22)25-21)20(6)12-24-18(23)17(20)14(2)26-27(7,8)19(3,4)5/h11,13H,9-10,12H2,1-8H3/b17-14-/t13-,20-,21+/m1/s1 |
| InChIKey | ZABCLRITDABAJE-ZIFCNFRCSA-N |
| XLogP | 4.50 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|