C15H17LiO5 — CID 139598338
lithium (1Z)-1-[(4S)-4-[(4R,6aS)-4-methyl-2-oxo-5,6-dihydro-4H-cyclopenta[b]furan-6a-yl]-4-methyl-2-oxooxolan-3-ylidene]ethanolate (PubChem CID 139598338) has the molecular formula C15H17LiO5 and a molecular weight of 284.24 g/mol. Its IUPAC name is lithium (1Z)-1-[(4S)-4-[(4R,6aS)-4-methyl-2-oxo-5,6-dihydro-4H-cyclopenta[b]furan-6a-yl]-4-methyl-2-oxooxolan-3-ylidene]ethanolate.
| Compound Name | lithium (1Z)-1-[(4S)-4-[(4R,6aS)-4-methyl-2-oxo-5,6-dihydro-4H-cyclopenta[b]furan-6a-yl]-4-methyl-2-oxooxolan-3-ylidene]ethanolate |
|---|---|
| PubChem CID | 139598338 |
| Molecular Formula | C15H17LiO5 |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | lithium (1Z)-1-[(4S)-4-[(4R,6aS)-4-methyl-2-oxo-5,6-dihydro-4H-cyclopenta[b]furan-6a-yl]-4-methyl-2-oxooxolan-3-ylidene]ethanolate |
| SMILES | C/C([O-])=C1/C(=O)OC[C@@]1(C)[C@]12CC[C@@H](C)C1=CC(=O)O2.[Li+] |
| InChI | InChI=1S/C15H18O5.Li/c1-8-4-5-15(10(8)6-11(17)20-15)14(3)7-19-13(18)12(14)9(2)16;/h6,8,16H,4-5,7H2,1-3H3;/q;+1/p-1/b12-9+;/t8-,14-,15+;/m1./s1 |
| InChIKey | MMYROLUYDBVBCN-WVMAJZQSSA-M |
| XLogP | -2.16 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|