C15H20O2 — CID 11139007
(1E,4S,7R,8Z,13R)-5,5,9-trimethyl-3-oxatricyclo[5.5.1.04,13]trideca-1(12),8-dien-2-one (PubChem CID 11139007) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is (1E,4S,7R,8Z,13R)-5,5,9-trimethyl-3-oxatricyclo[5.5.1.04,13]trideca-1(12),8-dien-2-one.
| Compound Name | (1E,4S,7R,8Z,13R)-5,5,9-trimethyl-3-oxatricyclo[5.5.1.04,13]trideca-1(12),8-dien-2-one |
|---|---|
| PubChem CID | 11139007 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (1E,4S,7R,8Z,13R)-5,5,9-trimethyl-3-oxatricyclo[5.5.1.04,13]trideca-1(12),8-dien-2-one |
| SMILES | C/C1=C/[C@H]2CC(C)(C)[C@H]3OC(=O)/C(=C/CC1)[C@@H]23 |
| InChI | InChI=1S/C15H20O2/c1-9-5-4-6-11-12-10(7-9)8-15(2,3)13(12)17-14(11)16/h6-7,10,12-13H,4-5,8H2,1-3H3/b9-7-,11-6+/t10-,12+,13-/m0/s1 |
| InChIKey | GCAJKQOJGNHDDF-OKVQVWOXSA-N |
| XLogP | 3.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|