C23H38O4Si — CID 10597492
(4S,5S)-5-[(4aS,8aR)-5,5,8a-trimethyl-3-oxo-4a,6,7,8-tetrahydro-4H-naphthalen-2-yl]-4-propan-2-yl-4-trimethylsilyloxyoxolan-2-one (PubChem CID 10597492) has the molecular formula C23H38O4Si and a molecular weight of 406.64 g/mol. Its IUPAC name is (4S,5S)-5-[(4aS,8aR)-5,5,8a-trimethyl-3-oxo-4a,6,7,8-tetrahydro-4H-naphthalen-2-yl]-4-propan-2-yl-4-trimethylsilyloxyoxolan-2-one.
| Compound Name | (4S,5S)-5-[(4aS,8aR)-5,5,8a-trimethyl-3-oxo-4a,6,7,8-tetrahydro-4H-naphthalen-2-yl]-4-propan-2-yl-4-trimethylsilyloxyoxolan-2-one |
|---|---|
| PubChem CID | 10597492 |
| Molecular Formula | C23H38O4Si |
| Molecular Weight | 406.64 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | (4S,5S)-5-[(4aS,8aR)-5,5,8a-trimethyl-3-oxo-4a,6,7,8-tetrahydro-4H-naphthalen-2-yl]-4-propan-2-yl-4-trimethylsilyloxyoxolan-2-one |
| SMILES | CC(C)[C@@]1(O[Si](C)(C)C)CC(=O)O[C@H]1C1=C[C@@]2(C)CCCC(C)(C)[C@@H]2CC1=O |
| InChI | InChI=1S/C23H38O4Si/c1-15(2)23(27-28(6,7)8)14-19(25)26-20(23)16-13-22(5)11-9-10-21(3,4)18(22)12-17(16)24/h13,15,18,20H,9-12,14H2,1-8H3/t18-,20-,22+,23-/m0/s1 |
| InChIKey | ITUIQUGVPXDKSC-MHADKKCISA-N |
| XLogP | 5.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.64 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|