C19H26O4 — CID 169408927
ethyl (E)-3-[(3aS,7aR)-3a-cyclohexyl-2-oxo-4,5-dihydro-3H-1-benzofuran-7a-yl]prop-2-enoate (PubChem CID 169408927) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is ethyl (E)-3-[(3aS,7aR)-3a-cyclohexyl-2-oxo-4,5-dihydro-3H-1-benzofuran-7a-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(3aS,7aR)-3a-cyclohexyl-2-oxo-4,5-dihydro-3H-1-benzofuran-7a-yl]prop-2-enoate |
|---|---|
| PubChem CID | 169408927 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | ethyl (E)-3-[(3aS,7aR)-3a-cyclohexyl-2-oxo-4,5-dihydro-3H-1-benzofuran-7a-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@]12C=CCC[C@@]1(C1CCCCC1)CC(=O)O2 |
| InChI | InChI=1S/C19H26O4/c1-2-22-16(20)10-13-19-12-7-6-11-18(19,14-17(21)23-19)15-8-4-3-5-9-15/h7,10,12-13,15H,2-6,8-9,11,14H2,1H3/b13-10+/t18-,19+/m0/s1 |
| InChIKey | NXSSTEKJTMKNIV-HEBLUMGWSA-N |
| XLogP | 3.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|