C27H42O4Si — CID 11026892
[(1R,4R,13S)-13-[tert-butyl(dimethyl)silyl]oxy-12,15,15-trimethyl-9-methylidene-2-oxo-4-tricyclo[9.3.1.03,8]pentadeca-3(8),11-dienyl] acetate (PubChem CID 11026892) has the molecular formula C27H42O4Si and a molecular weight of 458.72 g/mol. Its IUPAC name is [(1R,4R,13S)-13-[tert-butyl(dimethyl)silyl]oxy-12,15,15-trimethyl-9-methylidene-2-oxo-4-tricyclo[9.3.1.03,8]pentadeca-3(8),11-dienyl] acetate.
| Compound Name | [(1R,4R,13S)-13-[tert-butyl(dimethyl)silyl]oxy-12,15,15-trimethyl-9-methylidene-2-oxo-4-tricyclo[9.3.1.03,8]pentadeca-3(8),11-dienyl] acetate |
|---|---|
| PubChem CID | 11026892 |
| Molecular Formula | C27H42O4Si |
| Molecular Weight | 458.72 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | [(1R,4R,13S)-13-[tert-butyl(dimethyl)silyl]oxy-12,15,15-trimethyl-9-methylidene-2-oxo-4-tricyclo[9.3.1.03,8]pentadeca-3(8),11-dienyl] acetate |
| SMILES | C=C1CC2=C(C)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H](C(=O)C3=C1CCC[C@H]3OC(C)=O)C2(C)C |
| InChI | InChI=1S/C27H42O4Si/c1-16-14-20-17(2)23(31-32(9,10)26(4,5)6)15-21(27(20,7)8)25(29)24-19(16)12-11-13-22(24)30-18(3)28/h21-23H,1,11-15H2,2-10H3/t21-,22+,23-/m0/s1 |
| InChIKey | YPZIDRBPQHURSJ-ZRBLBEILSA-N |
| XLogP | 6.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.72 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|