C34H62O4Si2 — CID 11114602
(1R,2S,3R,8S,13S)-13-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-12,15,15-trimethyl-5-tri(propan-2-yl)silyloxytricyclo[9.3.1.03,8]pentadeca-4,11-dien-9-one (PubChem CID 11114602) has the molecular formula C34H62O4Si2 and a molecular weight of 591.04 g/mol. Its IUPAC name is (1R,2S,3R,8S,13S)-13-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-12,15,15-trimethyl-5-tri(propan-2-yl)silyloxytricyclo[9.3.1.03,8]pentadeca-4,11-dien-9-one.
| Compound Name | (1R,2S,3R,8S,13S)-13-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-12,15,15-trimethyl-5-tri(propan-2-yl)silyloxytricyclo[9.3.1.03,8]pentadeca-4,11-dien-9-one |
|---|---|
| PubChem CID | 11114602 |
| Molecular Formula | C34H62O4Si2 |
| Molecular Weight | 591.04 g/mol |
| Exact Mass | 590.42 |
| IUPAC Name | (1R,2S,3R,8S,13S)-13-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-12,15,15-trimethyl-5-tri(propan-2-yl)silyloxytricyclo[9.3.1.03,8]pentadeca-4,11-dien-9-one |
| SMILES | CO[C@H]1[C@@H]2C=C(O[Si](C(C)C)(C(C)C)C(C)C)CC[C@@H]2C(=O)CC2=C(C)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1C2(C)C |
| InChI | InChI=1S/C34H62O4Si2/c1-21(2)40(22(3)4,23(5)6)37-25-16-17-26-27(18-25)32(36-13)29-20-31(38-39(14,15)33(8,9)10)24(7)28(19-30(26)35)34(29,11)12/h18,21-23,26-27,29,31-32H,16-17,19-20H2,1-15H3/t26-,27+,29-,31-,32-/m0/s1 |
| InChIKey | QFGOKAWWWUQRII-LKEYKECPSA-N |
| XLogP | 9.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.04 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|