C21H38O4Si — CID 11058065
[(1S,3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4-methylidene-3-(3-oxobutyl)cyclohexyl] acetate (PubChem CID 11058065) has the molecular formula C21H38O4Si and a molecular weight of 382.62 g/mol. Its IUPAC name is [(1S,3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4-methylidene-3-(3-oxobutyl)cyclohexyl] acetate.
| Compound Name | [(1S,3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4-methylidene-3-(3-oxobutyl)cyclohexyl] acetate |
|---|---|
| PubChem CID | 11058065 |
| Molecular Formula | C21H38O4Si |
| Molecular Weight | 382.62 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | [(1S,3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4-methylidene-3-(3-oxobutyl)cyclohexyl] acetate |
| SMILES | C=C1[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](OC(C)=O)C(C)(C)[C@@H]1CCC(C)=O |
| InChI | InChI=1S/C21H38O4Si/c1-14(22)11-12-17-15(2)18(25-26(9,10)20(4,5)6)13-19(21(17,7)8)24-16(3)23/h17-19H,2,11-13H2,1,3-10H3/t17-,18+,19+/m1/s1 |
| InChIKey | PZZPKLCFKNFUGZ-QYZOEREBSA-N |
| XLogP | 5.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.62 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|