C25H42O4Si — CID 100943967
methyl (1S,4aS,5R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-1,4a-dimethyl-6-methylidene-5-[(Z)-3-oxobut-1-enyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate (PubChem CID 100943967) has the molecular formula C25H42O4Si and a molecular weight of 434.69 g/mol. Its IUPAC name is methyl (1S,4aS,5R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-1,4a-dimethyl-6-methylidene-5-[(Z)-3-oxobut-1-enyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate.
| Compound Name | methyl (1S,4aS,5R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-1,4a-dimethyl-6-methylidene-5-[(Z)-3-oxobut-1-enyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 100943967 |
| Molecular Formula | C25H42O4Si |
| Molecular Weight | 434.69 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | methyl (1S,4aS,5R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-1,4a-dimethyl-6-methylidene-5-[(Z)-3-oxobut-1-enyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
| SMILES | C=C1[C@H](O[Si](C)(C)C(C)(C)C)CC2[C@](C)(CCC[C@]2(C)C(=O)OC)[C@H]1/C=C\C(C)=O |
| InChI | InChI=1S/C25H42O4Si/c1-17(26)12-13-19-18(2)20(29-30(9,10)23(3,4)5)16-21-24(19,6)14-11-15-25(21,7)22(27)28-8/h12-13,19-21H,2,11,14-16H2,1,3-10H3/b13-12-/t19-,20+,21?,24+,25-/m0/s1 |
| InChIKey | ISXRJHOCOGPQBU-YFCGACBZSA-N |
| XLogP | 6.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.69 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|