C20H27F3O6 — CID 11177614
methyl (1S,4aR,5R,7R)-5-(2-methoxy-2-oxoethyl)-1,4a-dimethyl-6-methylidene-7-(2,2,2-trifluoroacetyl)oxy-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate (PubChem CID 11177614) has the molecular formula C20H27F3O6 and a molecular weight of 420.42 g/mol. Its IUPAC name is methyl (1S,4aR,5R,7R)-5-(2-methoxy-2-oxoethyl)-1,4a-dimethyl-6-methylidene-7-(2,2,2-trifluoroacetyl)oxy-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate.
| Compound Name | methyl (1S,4aR,5R,7R)-5-(2-methoxy-2-oxoethyl)-1,4a-dimethyl-6-methylidene-7-(2,2,2-trifluoroacetyl)oxy-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 11177614 |
| Molecular Formula | C20H27F3O6 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | methyl (1S,4aR,5R,7R)-5-(2-methoxy-2-oxoethyl)-1,4a-dimethyl-6-methylidene-7-(2,2,2-trifluoroacetyl)oxy-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
| SMILES | C=C1[C@H](OC(=O)C(F)(F)F)CC2[C@](C)(CCC[C@]2(C)C(=O)OC)[C@H]1CC(=O)OC |
| InChI | InChI=1S/C20H27F3O6/c1-11-12(9-15(24)27-4)18(2)7-6-8-19(3,16(25)28-5)14(18)10-13(11)29-17(26)20(21,22)23/h12-14H,1,6-10H2,2-5H3/t12-,13+,14?,18+,19-/m0/s1 |
| InChIKey | UMBJGKAGIKSTNT-IARDWNLSSA-N |
| XLogP | 3.59 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|