C26H40O5Si — CID 10972589
(1R,2R,6S,9S,10S)-10-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-5,9,17,17-tetramethyl-15-oxatetracyclo[7.6.1.12,6.013,16]heptadeca-4,13(16)-diene-7,14-dione (PubChem CID 10972589) has the molecular formula C26H40O5Si and a molecular weight of 460.69 g/mol. Its IUPAC name is (1R,2R,6S,9S,10S)-10-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-5,9,17,17-tetramethyl-15-oxatetracyclo[7.6.1.12,6.013,16]heptadeca-4,13(16)-diene-7,14-dione.
| Compound Name | (1R,2R,6S,9S,10S)-10-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-5,9,17,17-tetramethyl-15-oxatetracyclo[7.6.1.12,6.013,16]heptadeca-4,13(16)-diene-7,14-dione |
|---|---|
| PubChem CID | 10972589 |
| Molecular Formula | C26H40O5Si |
| Molecular Weight | 460.69 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | (1R,2R,6S,9S,10S)-10-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-5,9,17,17-tetramethyl-15-oxatetracyclo[7.6.1.12,6.013,16]heptadeca-4,13(16)-diene-7,14-dione |
| SMILES | CC1=CC[C@@H]2C(C)(C)[C@H]1C(=O)C[C@@]1(C)C3=C(CC[C@@H]1O[Si](C)(C)C(C)(C)C)C(=O)O[C@@]32O |
| InChI | InChI=1S/C26H40O5Si/c1-15-10-12-18-24(5,6)20(15)17(27)14-25(7)19(31-32(8,9)23(2,3)4)13-11-16-21(25)26(18,29)30-22(16)28/h10,18-20,29H,11-14H2,1-9H3/t18-,19+,20-,25-,26-/m1/s1 |
| InChIKey | CRMHVSNARAVYKH-OAHQXQCPSA-N |
| XLogP | 5.30 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.69 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|