C27H42O5Si — CID 10928859
methyl (1R,3S,7S,8S,11S)-7-[tert-butyl(dimethyl)silyl]oxy-8,12,15,15-tetramethyl-2,10-dioxotricyclo[9.3.1.03,8]pentadeca-4,12-diene-4-carboxylate (PubChem CID 10928859) has the molecular formula C27H42O5Si and a molecular weight of 474.71 g/mol. Its IUPAC name is methyl (1R,3S,7S,8S,11S)-7-[tert-butyl(dimethyl)silyl]oxy-8,12,15,15-tetramethyl-2,10-dioxotricyclo[9.3.1.03,8]pentadeca-4,12-diene-4-carboxylate.
| Compound Name | methyl (1R,3S,7S,8S,11S)-7-[tert-butyl(dimethyl)silyl]oxy-8,12,15,15-tetramethyl-2,10-dioxotricyclo[9.3.1.03,8]pentadeca-4,12-diene-4-carboxylate |
|---|---|
| PubChem CID | 10928859 |
| Molecular Formula | C27H42O5Si |
| Molecular Weight | 474.71 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | methyl (1R,3S,7S,8S,11S)-7-[tert-butyl(dimethyl)silyl]oxy-8,12,15,15-tetramethyl-2,10-dioxotricyclo[9.3.1.03,8]pentadeca-4,12-diene-4-carboxylate |
| SMILES | COC(=O)C1=CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@]2(C)CC(=O)[C@H]3C(C)=CC[C@@H](C(=O)[C@H]12)C3(C)C |
| InChI | InChI=1S/C27H42O5Si/c1-16-11-13-18-23(29)22-17(24(30)31-8)12-14-20(32-33(9,10)25(2,3)4)27(22,7)15-19(28)21(16)26(18,5)6/h11-12,18,20-22H,13-15H2,1-10H3/t18-,20-,21+,22-,27+/m0/s1 |
| InChIKey | AQHWIIRKAYQKQN-CHOXQVDLSA-N |
| XLogP | 5.65 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.71 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|