C21H34O5Si — CID 154716462
[(1R,4S,7R,9S,12R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-3-oxo-2-oxatricyclo[6.3.1.04,12]dodec-10-en-9-yl] acetate (PubChem CID 154716462) has the molecular formula C21H34O5Si and a molecular weight of 394.58 g/mol. Its IUPAC name is [(1R,4S,7R,9S,12R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-3-oxo-2-oxatricyclo[6.3.1.04,12]dodec-10-en-9-yl] acetate.
| Compound Name | [(1R,4S,7R,9S,12R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-3-oxo-2-oxatricyclo[6.3.1.04,12]dodec-10-en-9-yl] acetate |
|---|---|
| PubChem CID | 154716462 |
| Molecular Formula | C21H34O5Si |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | [(1R,4S,7R,9S,12R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-3-oxo-2-oxatricyclo[6.3.1.04,12]dodec-10-en-9-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C[C@H]2OC(=O)[C@@]3(C)CCC(CO[Si](C)(C)C(C)(C)C)C1[C@@H]23 |
| InChI | InChI=1S/C21H34O5Si/c1-13(22)25-15-8-9-16-18-17(15)14(10-11-21(18,5)19(23)26-16)12-24-27(6,7)20(2,3)4/h8-9,14-18H,10-12H2,1-7H3/t14?,15-,16+,17?,18+,21-/m0/s1 |
| InChIKey | LYSLHDZTALXPJU-PDPVFVJPSA-N |
| XLogP | 4.08 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|