C23H36O5Si — CID 174021846
methyl 2-[(1R,4R,8R,9R,12R)-4,8-dimethyl-10-methylidene-3-oxo-11-triethylsilyloxy-2-oxatricyclo[6.3.1.04,12]dodec-5-en-9-yl]acetate (PubChem CID 174021846) has the molecular formula C23H36O5Si and a molecular weight of 420.62 g/mol. Its IUPAC name is methyl 2-[(1R,4R,8R,9R,12R)-4,8-dimethyl-10-methylidene-3-oxo-11-triethylsilyloxy-2-oxatricyclo[6.3.1.04,12]dodec-5-en-9-yl]acetate.
| Compound Name | methyl 2-[(1R,4R,8R,9R,12R)-4,8-dimethyl-10-methylidene-3-oxo-11-triethylsilyloxy-2-oxatricyclo[6.3.1.04,12]dodec-5-en-9-yl]acetate |
|---|---|
| PubChem CID | 174021846 |
| Molecular Formula | C23H36O5Si |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | methyl 2-[(1R,4R,8R,9R,12R)-4,8-dimethyl-10-methylidene-3-oxo-11-triethylsilyloxy-2-oxatricyclo[6.3.1.04,12]dodec-5-en-9-yl]acetate |
| SMILES | C=C1C(O[Si](CC)(CC)CC)[C@@H]2OC(=O)[C@]3(C)C=CC[C@@](C)([C@@H]23)[C@H]1CC(=O)OC |
| InChI | InChI=1S/C23H36O5Si/c1-8-29(9-2,10-3)28-18-15(4)16(14-17(24)26-7)22(5)12-11-13-23(6)20(22)19(18)27-21(23)25/h11,13,16,18-20H,4,8-10,12,14H2,1-3,5-7H3/t16-,18?,19-,20+,22+,23+/m0/s1 |
| InChIKey | CAOULRQGQICWKR-CZWPSWFYSA-N |
| XLogP | 4.64 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|