C26H50O5Si2 — CID 102220999
ethyl (4R)-2-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]-3-oxo-4-(triethylsilyloxymethyl)hexanoate (PubChem CID 102220999) has the molecular formula C26H50O5Si2 and a molecular weight of 498.85 g/mol. Its IUPAC name is ethyl (4R)-2-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]-3-oxo-4-(triethylsilyloxymethyl)hexanoate.
| Compound Name | ethyl (4R)-2-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]-3-oxo-4-(triethylsilyloxymethyl)hexanoate |
|---|---|
| PubChem CID | 102220999 |
| Molecular Formula | C26H50O5Si2 |
| Molecular Weight | 498.85 g/mol |
| Exact Mass | 498.32 |
| IUPAC Name | ethyl (4R)-2-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]-3-oxo-4-(triethylsilyloxymethyl)hexanoate |
| SMILES | CCOC(=O)C(C(=O)[C@H](CC)CO[Si](CC)(CC)CC)[C@H]1C=C[C@@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C26H50O5Si2/c1-11-20(19-30-33(13-3,14-4)15-5)24(27)23(25(28)29-12-2)21-16-17-22(18-21)31-32(9,10)26(6,7)8/h16-17,20-23H,11-15,18-19H2,1-10H3/t20-,21+,22-,23?/m1/s1 |
| InChIKey | USAROWKWKZRZJC-VNYJYPEVSA-N |
| XLogP | 6.75 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.85 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|