C26H50O5Si2 — CID 134835113
ethyl 2-[(1R,2S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-1-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]-3-oxocyclohexyl]acetate (PubChem CID 134835113) has the molecular formula C26H50O5Si2 and a molecular weight of 498.85 g/mol. Its IUPAC name is ethyl 2-[(1R,2S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-1-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]-3-oxocyclohexyl]acetate.
| Compound Name | ethyl 2-[(1R,2S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-1-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]-3-oxocyclohexyl]acetate |
|---|---|
| PubChem CID | 134835113 |
| Molecular Formula | C26H50O5Si2 |
| Molecular Weight | 498.85 g/mol |
| Exact Mass | 498.32 |
| IUPAC Name | ethyl 2-[(1R,2S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-1-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]-3-oxocyclohexyl]acetate |
| SMILES | C/C=C/C(O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CC(=O)OCC |
| InChI | InChI=1S/C26H50O5Si2/c1-13-15-22(31-33(11,12)26(6,7)8)24-19(18-23(28)29-14-2)21(17-16-20(24)27)30-32(9,10)25(3,4)5/h13,15,19,21-22,24H,14,16-18H2,1-12H3/b15-13+/t19-,21-,22?,24+/m0/s1 |
| InChIKey | YMHKOFUEFYHZDT-BOVRGLCKSA-N |
| XLogP | 6.89 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.85 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|