C19H32O4Si — CID 134835118
methyl (1S,2S,4aR,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-oxo-2,4a,6,7,8,8a-hexahydro-1H-naphthalene-1-carboxylate (PubChem CID 134835118) has the molecular formula C19H32O4Si and a molecular weight of 352.55 g/mol. Its IUPAC name is methyl (1S,2S,4aR,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-oxo-2,4a,6,7,8,8a-hexahydro-1H-naphthalene-1-carboxylate.
| Compound Name | methyl (1S,2S,4aR,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-oxo-2,4a,6,7,8,8a-hexahydro-1H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 134835118 |
| Molecular Formula | C19H32O4Si |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | methyl (1S,2S,4aR,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-oxo-2,4a,6,7,8,8a-hexahydro-1H-naphthalene-1-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC(=O)[C@@H]2C=C[C@@H]1C |
| InChI | InChI=1S/C19H32O4Si/c1-12-8-9-13-14(20)10-11-15(17(13)16(12)18(21)22-5)23-24(6,7)19(2,3)4/h8-9,12-13,15-17H,10-11H2,1-7H3/t12-,13-,15-,16-,17+/m0/s1 |
| InChIKey | QHXSZCRYTZEYJA-XPYWIHLFSA-N |
| XLogP | 3.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|