C22H40O4Si — CID 57285152
ethyl (1S,2S,4aR,6S,8S)-8-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-2,6-dimethyl-2,4a,5,7,8,8a-hexahydro-1H-naphthalene-1-carboxylate (PubChem CID 57285152) has the molecular formula C22H40O4Si and a molecular weight of 396.64 g/mol. Its IUPAC name is ethyl (1S,2S,4aR,6S,8S)-8-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-2,6-dimethyl-2,4a,5,7,8,8a-hexahydro-1H-naphthalene-1-carboxylate.
| Compound Name | ethyl (1S,2S,4aR,6S,8S)-8-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-2,6-dimethyl-2,4a,5,7,8,8a-hexahydro-1H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 57285152 |
| Molecular Formula | C22H40O4Si |
| Molecular Weight | 396.64 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | ethyl (1S,2S,4aR,6S,8S)-8-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-2,6-dimethyl-2,4a,5,7,8,8a-hexahydro-1H-naphthalene-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C2C(O[Si](C)(C)C(C)(C)C)C[C@@](C)(CO)C[C@@H]2C=C[C@@H]1C |
| InChI | InChI=1S/C22H40O4Si/c1-9-25-20(24)18-15(2)10-11-16-12-22(6,14-23)13-17(19(16)18)26-27(7,8)21(3,4)5/h10-11,15-19,23H,9,12-14H2,1-8H3/t15-,16-,17?,18-,19?,22-/m0/s1 |
| InChIKey | UDYUYBCYWKYFGS-YXHUJXMVSA-N |
| XLogP | 4.79 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.64 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|