C17H30ClNO4Si — CID 57325559
ethyl (2R,3aS,8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-3a-chloro-1,2,3,4,8,8a-hexahydrooxepino[4,3-b]pyrrole-2-carboxylate (PubChem CID 57325559) has the molecular formula C17H30ClNO4Si and a molecular weight of 375.97 g/mol. Its IUPAC name is ethyl (2R,3aS,8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-3a-chloro-1,2,3,4,8,8a-hexahydrooxepino[4,3-b]pyrrole-2-carboxylate.
| Compound Name | ethyl (2R,3aS,8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-3a-chloro-1,2,3,4,8,8a-hexahydrooxepino[4,3-b]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 57325559 |
| Molecular Formula | C17H30ClNO4Si |
| Molecular Weight | 375.97 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | ethyl (2R,3aS,8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-3a-chloro-1,2,3,4,8,8a-hexahydrooxepino[4,3-b]pyrrole-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@@]2(Cl)COC=C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N1 |
| InChI | InChI=1S/C17H30ClNO4Si/c1-7-22-15(20)12-10-17(18)11-21-9-8-13(14(17)19-12)23-24(5,6)16(2,3)4/h8-9,12-14,19H,7,10-11H2,1-6H3/t12-,13+,14-,17-/m1/s1 |
| InChIKey | CIWLVTJGPATHAN-UMPJEAMMSA-N |
| XLogP | 3.19 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.97 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|