C16H27NO4Si — CID 71518134
methyl (2S,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2,3,8,8a-tetrahydro-1H-oxepino[4,3-b]pyrrole-2-carboxylate (PubChem CID 71518134) has the molecular formula C16H27NO4Si and a molecular weight of 325.48 g/mol. Its IUPAC name is methyl (2S,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2,3,8,8a-tetrahydro-1H-oxepino[4,3-b]pyrrole-2-carboxylate.
| Compound Name | methyl (2S,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2,3,8,8a-tetrahydro-1H-oxepino[4,3-b]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 71518134 |
| Molecular Formula | C16H27NO4Si |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | methyl (2S,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2,3,8,8a-tetrahydro-1H-oxepino[4,3-b]pyrrole-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CC2=COC=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2N1 |
| InChI | InChI=1S/C16H27NO4Si/c1-16(2,3)22(5,6)21-13-7-8-20-10-11-9-12(15(18)19-4)17-14(11)13/h7-8,10,12-14,17H,9H2,1-6H3/t12-,13+,14-/m0/s1 |
| InChIKey | PWYIHEBWPIODRH-MJBXVCDLSA-N |
| XLogP | 2.71 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|