C16H24O5 — CID 10447272
1-O-ethyl 6-O-methyl (1S,2S,6S,8S)-8-hydroxy-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1,6-dicarboxylate (PubChem CID 10447272) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is 1-O-ethyl 6-O-methyl (1S,2S,6S,8S)-8-hydroxy-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1,6-dicarboxylate.
| Compound Name | 1-O-ethyl 6-O-methyl (1S,2S,6S,8S)-8-hydroxy-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1,6-dicarboxylate |
|---|---|
| PubChem CID | 10447272 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 1-O-ethyl 6-O-methyl (1S,2S,6S,8S)-8-hydroxy-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1,6-dicarboxylate |
| SMILES | CCOC(=O)C1C2C(C=C[C@@H]1C)C[C@H](C(=O)OC)C[C@@H]2O |
| InChI | InChI=1S/C16H24O5/c1-4-21-16(19)13-9(2)5-6-10-7-11(15(18)20-3)8-12(17)14(10)13/h5-6,9-14,17H,4,7-8H2,1-3H3/t9-,10?,11-,12-,13?,14?/m0/s1 |
| InChIKey | PQWKMNUMPNERCA-LJJHSKGXSA-N |
| XLogP | 1.55 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|