C28H44O6SSi — CID 10482319
ethyl (1S,2S,6S,8S)-8-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-[(4-methylphenyl)sulfonyloxymethyl]-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carboxylate (PubChem CID 10482319) has the molecular formula C28H44O6SSi and a molecular weight of 536.81 g/mol. Its IUPAC name is ethyl (1S,2S,6S,8S)-8-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-[(4-methylphenyl)sulfonyloxymethyl]-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carboxylate.
| Compound Name | ethyl (1S,2S,6S,8S)-8-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-[(4-methylphenyl)sulfonyloxymethyl]-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 10482319 |
| Molecular Formula | C28H44O6SSi |
| Molecular Weight | 536.81 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | ethyl (1S,2S,6S,8S)-8-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-[(4-methylphenyl)sulfonyloxymethyl]-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carboxylate |
| SMILES | CCOC(=O)C1C2C(C=C[C@@H]1C)C[C@H](COS(=O)(=O)c1ccc(C)cc1)C[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H44O6SSi/c1-9-32-27(29)25-20(3)12-13-22-16-21(17-24(26(22)25)34-36(7,8)28(4,5)6)18-33-35(30,31)23-14-10-19(2)11-15-23/h10-15,20-22,24-26H,9,16-18H2,1-8H3/t20-,21-,22?,24-,25?,26?/m0/s1 |
| InChIKey | HTRPWAYFGDOLBR-RKZHUHOUSA-N |
| XLogP | 6.12 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.81 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|