C35H64O6Si2 — CID 10995817
[(1S)-1-[(2R,4R,7S,9S)-9-[tert-butyl(dimethyl)silyl]oxy-4,10,11,11-tetramethyl-5-oxo-2-triethylsilyloxy-4-bicyclo[5.3.1]undec-1(10)-enyl]pent-4-enyl] ethyl carbonate (PubChem CID 10995817) has the molecular formula C35H64O6Si2 and a molecular weight of 637.06 g/mol. Its IUPAC name is [(1S)-1-[(2R,4R,7S,9S)-9-[tert-butyl(dimethyl)silyl]oxy-4,10,11,11-tetramethyl-5-oxo-2-triethylsilyloxy-4-bicyclo[5.3.1]undec-1(10)-enyl]pent-4-enyl] ethyl carbonate.
| Compound Name | [(1S)-1-[(2R,4R,7S,9S)-9-[tert-butyl(dimethyl)silyl]oxy-4,10,11,11-tetramethyl-5-oxo-2-triethylsilyloxy-4-bicyclo[5.3.1]undec-1(10)-enyl]pent-4-enyl] ethyl carbonate |
|---|---|
| PubChem CID | 10995817 |
| Molecular Formula | C35H64O6Si2 |
| Molecular Weight | 637.06 g/mol |
| Exact Mass | 636.42 |
| IUPAC Name | [(1S)-1-[(2R,4R,7S,9S)-9-[tert-butyl(dimethyl)silyl]oxy-4,10,11,11-tetramethyl-5-oxo-2-triethylsilyloxy-4-bicyclo[5.3.1]undec-1(10)-enyl]pent-4-enyl] ethyl carbonate |
| SMILES | C=CCC[C@H](OC(=O)OCC)[C@@]1(C)C[C@@H](O[Si](CC)(CC)CC)C2=C(C)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H](CC1=O)C2(C)C |
| InChI | InChI=1S/C35H64O6Si2/c1-15-20-21-30(39-32(37)38-16-2)35(12)24-28(41-43(17-3,18-4)19-5)31-25(6)27(40-42(13,14)33(7,8)9)22-26(23-29(35)36)34(31,10)11/h15,26-28,30H,1,16-24H2,2-14H3/t26-,27-,28+,30-,35-/m0/s1 |
| InChIKey | HNGHSNXZFOBHBN-BQMUAMPLSA-N |
| XLogP | 10.01 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.06 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|