C27H50O4Si — CID 10906740
(1S,4R)-4-[(1S)-4-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)butyl]-4,8,11,11-tetramethylbicyclo[5.3.1]undec-7-en-3-one (PubChem CID 10906740) has the molecular formula C27H50O4Si and a molecular weight of 466.78 g/mol. Its IUPAC name is (1S,4R)-4-[(1S)-4-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)butyl]-4,8,11,11-tetramethylbicyclo[5.3.1]undec-7-en-3-one.
| Compound Name | (1S,4R)-4-[(1S)-4-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)butyl]-4,8,11,11-tetramethylbicyclo[5.3.1]undec-7-en-3-one |
|---|---|
| PubChem CID | 10906740 |
| Molecular Formula | C27H50O4Si |
| Molecular Weight | 466.78 g/mol |
| Exact Mass | 466.35 |
| IUPAC Name | (1S,4R)-4-[(1S)-4-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)butyl]-4,8,11,11-tetramethylbicyclo[5.3.1]undec-7-en-3-one |
| SMILES | COCO[C@@H](CCCO[Si](C)(C)C(C)(C)C)[C@@]1(C)CCC2=C(C)CC[C@@H](CC1=O)C2(C)C |
| InChI | InChI=1S/C27H50O4Si/c1-20-13-14-21-18-23(28)27(7,16-15-22(20)26(21,5)6)24(30-19-29-8)12-11-17-31-32(9,10)25(2,3)4/h21,24H,11-19H2,1-10H3/t21-,24-,27-/m0/s1 |
| InChIKey | WTOCHUJILNPZQJ-DDZLNHKNSA-N |
| XLogP | 7.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.78 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|