C39H70O6Si2 — CID 134870961
(7S,8R,10R,13S)-7-but-3-enyl-13-[tert-butyl(dimethyl)silyl]oxy-8,12,15,15-tetramethyl-10-tributylsilyloxy-4,6-dioxatricyclo[9.3.1.03,8]pentadec-11-ene-2,5-dione (PubChem CID 134870961) has the molecular formula C39H70O6Si2 and a molecular weight of 691.15 g/mol. Its IUPAC name is (7S,8R,10R,13S)-7-but-3-enyl-13-[tert-butyl(dimethyl)silyl]oxy-8,12,15,15-tetramethyl-10-tributylsilyloxy-4,6-dioxatricyclo[9.3.1.03,8]pentadec-11-ene-2,5-dione.
| Compound Name | (7S,8R,10R,13S)-7-but-3-enyl-13-[tert-butyl(dimethyl)silyl]oxy-8,12,15,15-tetramethyl-10-tributylsilyloxy-4,6-dioxatricyclo[9.3.1.03,8]pentadec-11-ene-2,5-dione |
|---|---|
| PubChem CID | 134870961 |
| Molecular Formula | C39H70O6Si2 |
| Molecular Weight | 691.15 g/mol |
| Exact Mass | 690.47 |
| IUPAC Name | (7S,8R,10R,13S)-7-but-3-enyl-13-[tert-butyl(dimethyl)silyl]oxy-8,12,15,15-tetramethyl-10-tributylsilyloxy-4,6-dioxatricyclo[9.3.1.03,8]pentadec-11-ene-2,5-dione |
| SMILES | C=CCC[C@@H]1OC(=O)OC2C(=O)C3C[C@H](O[Si](C)(C)C(C)(C)C)C(C)=C([C@H](O[Si](CCCC)(CCCC)CCCC)C[C@@]21C)C3(C)C |
| InChI | InChI=1S/C39H70O6Si2/c1-14-18-22-32-39(11)27-31(45-47(23-19-15-2,24-20-16-3)25-21-17-4)33-28(5)30(44-46(12,13)37(6,7)8)26-29(38(33,9)10)34(40)35(39)43-36(41)42-32/h14,29-32,35H,1,15-27H2,2-13H3/t29?,30-,31+,32-,35?,39+/m0/s1 |
| InChIKey | BLFQRNFLFRPSQO-UDORZSJISA-N |
| XLogP | 11.32 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.15 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|