C27H44O6Si — CID 10994610
(3S,7S,8R,10R,13S)-7-but-3-enyl-13-hydroxy-8,12,15,15-tetramethyl-10-triethylsilyloxy-4,6-dioxatricyclo[9.3.1.03,8]pentadec-11-ene-2,5-dione (PubChem CID 10994610) has the molecular formula C27H44O6Si and a molecular weight of 492.73 g/mol. Its IUPAC name is (3S,7S,8R,10R,13S)-7-but-3-enyl-13-hydroxy-8,12,15,15-tetramethyl-10-triethylsilyloxy-4,6-dioxatricyclo[9.3.1.03,8]pentadec-11-ene-2,5-dione.
| Compound Name | (3S,7S,8R,10R,13S)-7-but-3-enyl-13-hydroxy-8,12,15,15-tetramethyl-10-triethylsilyloxy-4,6-dioxatricyclo[9.3.1.03,8]pentadec-11-ene-2,5-dione |
|---|---|
| PubChem CID | 10994610 |
| Molecular Formula | C27H44O6Si |
| Molecular Weight | 492.73 g/mol |
| Exact Mass | 492.29 |
| IUPAC Name | (3S,7S,8R,10R,13S)-7-but-3-enyl-13-hydroxy-8,12,15,15-tetramethyl-10-triethylsilyloxy-4,6-dioxatricyclo[9.3.1.03,8]pentadec-11-ene-2,5-dione |
| SMILES | C=CCC[C@@H]1OC(=O)O[C@@H]2C(=O)C3C[C@H](O)C(C)=C([C@H](O[Si](CC)(CC)CC)C[C@]12C)C3(C)C |
| InChI | InChI=1S/C27H44O6Si/c1-9-13-14-21-27(8)16-20(33-34(10-2,11-3)12-4)22-17(5)19(28)15-18(26(22,6)7)23(29)24(27)32-25(30)31-21/h9,18-21,24,28H,1,10-16H2,2-8H3/t18?,19-,20+,21-,24+,27+/m0/s1 |
| InChIKey | UFBLNAKIMHLYBI-LBOWIGJSSA-N |
| XLogP | 5.95 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.73 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|