C32H52O8Si2 — CID 164672319
[(1S,5S,6R,10S,11S,13R,16S)-7,11,15,18,18-pentamethyl-3,12-dioxo-10-triethylsilyloxy-16-trimethylsilyloxy-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadeca-7,14-dien-13-yl] acetate (PubChem CID 164672319) has the molecular formula C32H52O8Si2 and a molecular weight of 620.93 g/mol. Its IUPAC name is [(1S,5S,6R,10S,11S,13R,16S)-7,11,15,18,18-pentamethyl-3,12-dioxo-10-triethylsilyloxy-16-trimethylsilyloxy-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadeca-7,14-dien-13-yl] acetate.
| Compound Name | [(1S,5S,6R,10S,11S,13R,16S)-7,11,15,18,18-pentamethyl-3,12-dioxo-10-triethylsilyloxy-16-trimethylsilyloxy-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadeca-7,14-dien-13-yl] acetate |
|---|---|
| PubChem CID | 164672319 |
| Molecular Formula | C32H52O8Si2 |
| Molecular Weight | 620.93 g/mol |
| Exact Mass | 620.32 |
| IUPAC Name | [(1S,5S,6R,10S,11S,13R,16S)-7,11,15,18,18-pentamethyl-3,12-dioxo-10-triethylsilyloxy-16-trimethylsilyloxy-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadeca-7,14-dien-13-yl] acetate |
| SMILES | CC[Si](CC)(CC)O[C@H]1CC=C(C)[C@H]2[C@@H]3OC(=O)O[C@]34C[C@H](O[Si](C)(C)C)C(C)=C([C@@H](OC(C)=O)C(=O)[C@]12C)C4(C)C |
| InChI | InChI=1S/C32H52O8Si2/c1-13-42(14-2,15-3)40-23-17-16-19(4)24-28-32(38-29(35)37-28)18-22(39-41(10,11)12)20(5)25(30(32,7)8)26(36-21(6)33)27(34)31(23,24)9/h16,22-24,26,28H,13-15,17-18H2,1-12H3/t22-,23-,24-,26+,28-,31+,32+/m0/s1 |
| InChIKey | IZBGKNHNZLKOHM-SAMUVVFMSA-N |
| XLogP | 7.10 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.93 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|