C35H58O8Si2 — CID 11028747
[(1S,5S,6R,10S,11S,13R,16S)-11,15,18,18-tetramethyl-7-methylidene-3,12-dioxo-10,16-bis(triethylsilyloxy)-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadec-14-en-13-yl] acetate (PubChem CID 11028747) has the molecular formula C35H58O8Si2 and a molecular weight of 663.01 g/mol. Its IUPAC name is [(1S,5S,6R,10S,11S,13R,16S)-11,15,18,18-tetramethyl-7-methylidene-3,12-dioxo-10,16-bis(triethylsilyloxy)-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadec-14-en-13-yl] acetate.
| Compound Name | [(1S,5S,6R,10S,11S,13R,16S)-11,15,18,18-tetramethyl-7-methylidene-3,12-dioxo-10,16-bis(triethylsilyloxy)-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadec-14-en-13-yl] acetate |
|---|---|
| PubChem CID | 11028747 |
| Molecular Formula | C35H58O8Si2 |
| Molecular Weight | 663.01 g/mol |
| Exact Mass | 662.37 |
| IUPAC Name | [(1S,5S,6R,10S,11S,13R,16S)-11,15,18,18-tetramethyl-7-methylidene-3,12-dioxo-10,16-bis(triethylsilyloxy)-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadec-14-en-13-yl] acetate |
| SMILES | C=C1CC[C@H](O[Si](CC)(CC)CC)[C@@]2(C)C(=O)[C@H](OC(C)=O)C3=C(C)[C@@H](O[Si](CC)(CC)CC)C[C@]4(OC(=O)O[C@H]4[C@H]12)C3(C)C |
| InChI | InChI=1S/C35H58O8Si2/c1-13-44(14-2,15-3)42-25-21-35-31(40-32(38)41-35)27-22(7)19-20-26(43-45(16-4,17-5)18-6)34(27,12)30(37)29(39-24(9)36)28(23(25)8)33(35,10)11/h25-27,29,31H,7,13-21H2,1-6,8-12H3/t25-,26-,27-,29+,31-,34+,35+/m0/s1 |
| InChIKey | UMNWTWONNDTMAL-LDKBAECWSA-N |
| XLogP | 8.27 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.01 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|