C29H42O8Si — CID 134859344
[(1S,5S,6R,10S,11S,13R)-11,15,18,18-tetramethyl-7-methylidene-3,12,16-trioxo-10-triethylsilyloxy-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadec-14-en-13-yl] acetate (PubChem CID 134859344) has the molecular formula C29H42O8Si and a molecular weight of 546.73 g/mol. Its IUPAC name is [(1S,5S,6R,10S,11S,13R)-11,15,18,18-tetramethyl-7-methylidene-3,12,16-trioxo-10-triethylsilyloxy-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadec-14-en-13-yl] acetate.
| Compound Name | [(1S,5S,6R,10S,11S,13R)-11,15,18,18-tetramethyl-7-methylidene-3,12,16-trioxo-10-triethylsilyloxy-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadec-14-en-13-yl] acetate |
|---|---|
| PubChem CID | 134859344 |
| Molecular Formula | C29H42O8Si |
| Molecular Weight | 546.73 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | [(1S,5S,6R,10S,11S,13R)-11,15,18,18-tetramethyl-7-methylidene-3,12,16-trioxo-10-triethylsilyloxy-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadec-14-en-13-yl] acetate |
| SMILES | C=C1CC[C@H](O[Si](CC)(CC)CC)[C@@]2(C)C(=O)[C@H](OC(C)=O)C3=C(C)C(=O)C[C@]4(OC(=O)O[C@H]4[C@H]12)C3(C)C |
| InChI | InChI=1S/C29H42O8Si/c1-10-38(11-2,12-3)37-20-14-13-16(4)21-25-29(36-26(33)35-25)15-19(31)17(5)22(27(29,7)8)23(34-18(6)30)24(32)28(20,21)9/h20-21,23,25H,4,10-15H2,1-3,5-9H3/t20-,21-,23+,25-,28+,29+/m0/s1 |
| InChIKey | JPEROPGSDIROAY-TULDBFCDSA-N |
| XLogP | 5.45 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.73 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|