C31H48O11Si — CID 10897444
[(1S,5S,6R,7S,8S,10S,11S,13R)-13-acetyloxy-7,8-dihydroxy-11,15,18,18-tetramethyl-3,12-dioxo-10-triethylsilyloxy-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadec-14-en-7-yl]methyl acetate (PubChem CID 10897444) has the molecular formula C31H48O11Si and a molecular weight of 624.80 g/mol. Its IUPAC name is [(1S,5S,6R,7S,8S,10S,11S,13R)-13-acetyloxy-7,8-dihydroxy-11,15,18,18-tetramethyl-3,12-dioxo-10-triethylsilyloxy-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadec-14-en-7-yl]methyl acetate.
| Compound Name | [(1S,5S,6R,7S,8S,10S,11S,13R)-13-acetyloxy-7,8-dihydroxy-11,15,18,18-tetramethyl-3,12-dioxo-10-triethylsilyloxy-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadec-14-en-7-yl]methyl acetate |
|---|---|
| PubChem CID | 10897444 |
| Molecular Formula | C31H48O11Si |
| Molecular Weight | 624.80 g/mol |
| Exact Mass | 624.30 |
| IUPAC Name | [(1S,5S,6R,7S,8S,10S,11S,13R)-13-acetyloxy-7,8-dihydroxy-11,15,18,18-tetramethyl-3,12-dioxo-10-triethylsilyloxy-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadec-14-en-7-yl]methyl acetate |
| SMILES | CC[Si](CC)(CC)O[C@H]1C[C@H](O)[C@@](O)(COC(C)=O)[C@H]2[C@@H]3OC(=O)O[C@]34CCC(C)=C([C@@H](OC(C)=O)C(=O)[C@]12C)C4(C)C |
| InChI | InChI=1S/C31H48O11Si/c1-10-43(11-2,12-3)42-21-15-20(34)30(37,16-38-18(5)32)24-26-31(41-27(36)40-26)14-13-17(4)22(28(31,7)8)23(39-19(6)33)25(35)29(21,24)9/h20-21,23-24,26,34,37H,10-16H2,1-9H3/t20-,21-,23+,24-,26-,29+,30-,31+/m0/s1 |
| InChIKey | JPGJZXGGUGBFJO-OSHOGPCKSA-N |
| XLogP | 3.98 |
| TPSA | 154.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.80 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|