C29H42O10Si — CID 10907986
[(1S,5S,6R,7S,10R,12S,13S,15R)-15-hydroxy-13,17,20,20-tetramethyl-3,14,18-trioxo-12-triethylsilyloxy-2,4,9-trioxapentacyclo[14.3.1.01,5.06,13.07,10]icos-16-en-7-yl] acetate (PubChem CID 10907986) has the molecular formula C29H42O10Si and a molecular weight of 578.73 g/mol. Its IUPAC name is [(1S,5S,6R,7S,10R,12S,13S,15R)-15-hydroxy-13,17,20,20-tetramethyl-3,14,18-trioxo-12-triethylsilyloxy-2,4,9-trioxapentacyclo[14.3.1.01,5.06,13.07,10]icos-16-en-7-yl] acetate.
| Compound Name | [(1S,5S,6R,7S,10R,12S,13S,15R)-15-hydroxy-13,17,20,20-tetramethyl-3,14,18-trioxo-12-triethylsilyloxy-2,4,9-trioxapentacyclo[14.3.1.01,5.06,13.07,10]icos-16-en-7-yl] acetate |
|---|---|
| PubChem CID | 10907986 |
| Molecular Formula | C29H42O10Si |
| Molecular Weight | 578.73 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | [(1S,5S,6R,7S,10R,12S,13S,15R)-15-hydroxy-13,17,20,20-tetramethyl-3,14,18-trioxo-12-triethylsilyloxy-2,4,9-trioxapentacyclo[14.3.1.01,5.06,13.07,10]icos-16-en-7-yl] acetate |
| SMILES | CC[Si](CC)(CC)O[C@H]1C[C@H]2OC[C@@]2(OC(C)=O)[C@H]2[C@@H]3OC(=O)O[C@]34CC(=O)C(C)=C([C@@H](O)C(=O)[C@]12C)C4(C)C |
| InChI | InChI=1S/C29H42O10Si/c1-9-40(10-2,11-3)39-18-12-19-28(14-35-19,37-16(5)30)22-24-29(38-25(34)36-24)13-17(31)15(4)20(26(29,6)7)21(32)23(33)27(18,22)8/h18-19,21-22,24,32H,9-14H2,1-8H3/t18-,19+,21+,22-,24-,27+,28-,29+/m0/s1 |
| InChIKey | OCHOEUUZHQCWIW-RIFKXWPOSA-N |
| XLogP | 3.64 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.73 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|