C25H32O11 — CID 10529630
[(1S,5S,7S,8S,11R,13R)-13-acetyloxy-7,8-dihydroxy-11,15,18,18-tetramethyl-3,12,16-trioxo-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadec-14-en-7-yl]methyl acetate (PubChem CID 10529630) has the molecular formula C25H32O11 and a molecular weight of 508.52 g/mol. Its IUPAC name is [(1S,5S,7S,8S,11R,13R)-13-acetyloxy-7,8-dihydroxy-11,15,18,18-tetramethyl-3,12,16-trioxo-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadec-14-en-7-yl]methyl acetate.
| Compound Name | [(1S,5S,7S,8S,11R,13R)-13-acetyloxy-7,8-dihydroxy-11,15,18,18-tetramethyl-3,12,16-trioxo-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadec-14-en-7-yl]methyl acetate |
|---|---|
| PubChem CID | 10529630 |
| Molecular Formula | C25H32O11 |
| Molecular Weight | 508.52 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | [(1S,5S,7S,8S,11R,13R)-13-acetyloxy-7,8-dihydroxy-11,15,18,18-tetramethyl-3,12,16-trioxo-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadec-14-en-7-yl]methyl acetate |
| SMILES | CC(=O)OCC1(O)C2[C@@H]3OC(=O)O[C@]34CC(=O)C(C)=C([C@@H](OC(C)=O)C(=O)[C@]2(C)CC[C@@H]1O)C4(C)C |
| InChI | InChI=1S/C25H32O11/c1-11-14(28)9-25-20(35-21(31)36-25)18-23(6,8-7-15(29)24(18,32)10-33-12(2)26)19(30)17(34-13(3)27)16(11)22(25,4)5/h15,17-18,20,29,32H,7-10H2,1-6H3/t15-,17+,18?,20-,23+,24?,25+/m0/s1 |
| InChIKey | YKKHDYNNWXRVMR-SAHHPBSESA-N |
| XLogP | 1.16 |
| TPSA | 162.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.52 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|