C34H66O7Si2 — CID 135043553
[(3R,4S)-4-hydroxy-4-methylhex-5-en-3-yl] (2R,3S,5R,6R,8R)-3-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2,6,8-trimethyl-9-oxo-5-triethylsilyloxyundec-10-enoate (PubChem CID 135043553) has the molecular formula C34H66O7Si2 and a molecular weight of 643.07 g/mol. Its IUPAC name is [(3R,4S)-4-hydroxy-4-methylhex-5-en-3-yl] (2R,3S,5R,6R,8R)-3-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2,6,8-trimethyl-9-oxo-5-triethylsilyloxyundec-10-enoate.
| Compound Name | [(3R,4S)-4-hydroxy-4-methylhex-5-en-3-yl] (2R,3S,5R,6R,8R)-3-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2,6,8-trimethyl-9-oxo-5-triethylsilyloxyundec-10-enoate |
|---|---|
| PubChem CID | 135043553 |
| Molecular Formula | C34H66O7Si2 |
| Molecular Weight | 643.07 g/mol |
| Exact Mass | 642.43 |
| IUPAC Name | [(3R,4S)-4-hydroxy-4-methylhex-5-en-3-yl] (2R,3S,5R,6R,8R)-3-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2,6,8-trimethyl-9-oxo-5-triethylsilyloxyundec-10-enoate |
| SMILES | C=CC(=O)[C@H](C)C[C@@](C)(OC)[C@@H](C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)O[C@H](CC)[C@@](C)(O)C=C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C34H66O7Si2/c1-17-27(35)25(7)24-34(13,38-14)30(41-43(20-4,21-5)22-6)23-28(40-42(15,16)32(9,10)11)26(8)31(36)39-29(18-2)33(12,37)19-3/h17,19,25-26,28-30,37H,1,3,18,20-24H2,2,4-16H3/t25-,26-,28+,29-,30-,33+,34-/m1/s1 |
| InChIKey | VSLBSRVXKLTSQW-VXWQITRKSA-N |
| XLogP | 8.24 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.07 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|