C20H32O6 — CID 163045265
(3R,5S,6R,7S,9R,11Z,13R,14R)-14-ethyl-6,13-dihydroxy-3,5,7,9,13-pentamethyl-1-oxacyclotetradec-11-ene-2,4,10-trione (PubChem CID 163045265) has the molecular formula C20H32O6 and a molecular weight of 368.47 g/mol. Its IUPAC name is (3R,5S,6R,7S,9R,11Z,13R,14R)-14-ethyl-6,13-dihydroxy-3,5,7,9,13-pentamethyl-1-oxacyclotetradec-11-ene-2,4,10-trione.
| Compound Name | (3R,5S,6R,7S,9R,11Z,13R,14R)-14-ethyl-6,13-dihydroxy-3,5,7,9,13-pentamethyl-1-oxacyclotetradec-11-ene-2,4,10-trione |
|---|---|
| PubChem CID | 163045265 |
| Molecular Formula | C20H32O6 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | (3R,5S,6R,7S,9R,11Z,13R,14R)-14-ethyl-6,13-dihydroxy-3,5,7,9,13-pentamethyl-1-oxacyclotetradec-11-ene-2,4,10-trione |
| SMILES | CC[C@H]1OC(=O)[C@H](C)C(=O)[C@@H](C)[C@H](O)[C@@H](C)C[C@@H](C)C(=O)/C=C\[C@@]1(C)O |
| InChI | InChI=1S/C20H32O6/c1-7-16-20(6,25)9-8-15(21)11(2)10-12(3)17(22)13(4)18(23)14(5)19(24)26-16/h8-9,11-14,16-17,22,25H,7,10H2,1-6H3/b9-8-/t11-,12+,13+,14-,16-,17-,20-/m1/s1 |
| InChIKey | LGZPXBXIIGFHEV-ASHIMXRXSA-N |
| XLogP | 2.06 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|