C24H48O6Si2 — CID 10601090
methyl 2-[(5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-prop-1-en-2-yl-5-(2-trimethylsilylethoxymethoxymethyl)oxolan-2-yl]acetate (PubChem CID 10601090) has the molecular formula C24H48O6Si2 and a molecular weight of 488.81 g/mol. Its IUPAC name is methyl 2-[(5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-prop-1-en-2-yl-5-(2-trimethylsilylethoxymethoxymethyl)oxolan-2-yl]acetate.
| Compound Name | methyl 2-[(5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-prop-1-en-2-yl-5-(2-trimethylsilylethoxymethoxymethyl)oxolan-2-yl]acetate |
|---|---|
| PubChem CID | 10601090 |
| Molecular Formula | C24H48O6Si2 |
| Molecular Weight | 488.81 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | methyl 2-[(5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-prop-1-en-2-yl-5-(2-trimethylsilylethoxymethoxymethyl)oxolan-2-yl]acetate |
| SMILES | C=C(C)[C@]1(COCOCC[Si](C)(C)C)CC(O[Si](C)(C)C(C)(C)C)C(C)(CC(=O)OC)O1 |
| InChI | InChI=1S/C24H48O6Si2/c1-19(2)24(17-28-18-27-13-14-31(8,9)10)15-20(29-32(11,12)22(3,4)5)23(6,30-24)16-21(25)26-7/h20H,1,13-18H2,2-12H3/t20?,23?,24-/m1/s1 |
| InChIKey | YMKCOZMDSZAUGR-VZYOYLOZSA-N |
| XLogP | 5.76 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.81 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|