C30H58O6Si2 — CID 101451603
methyl (4R,5R,6R)-6-heptyl-5-methyl-3-methylidene-4,5-bis(triethylsilyloxy)-4,6-dihydro-3aH-furo[2,3-b]pyran-7a-carboxylate (PubChem CID 101451603) has the molecular formula C30H58O6Si2 and a molecular weight of 570.96 g/mol. Its IUPAC name is methyl (4R,5R,6R)-6-heptyl-5-methyl-3-methylidene-4,5-bis(triethylsilyloxy)-4,6-dihydro-3aH-furo[2,3-b]pyran-7a-carboxylate.
| Compound Name | methyl (4R,5R,6R)-6-heptyl-5-methyl-3-methylidene-4,5-bis(triethylsilyloxy)-4,6-dihydro-3aH-furo[2,3-b]pyran-7a-carboxylate |
|---|---|
| PubChem CID | 101451603 |
| Molecular Formula | C30H58O6Si2 |
| Molecular Weight | 570.96 g/mol |
| Exact Mass | 570.38 |
| IUPAC Name | methyl (4R,5R,6R)-6-heptyl-5-methyl-3-methylidene-4,5-bis(triethylsilyloxy)-4,6-dihydro-3aH-furo[2,3-b]pyran-7a-carboxylate |
| SMILES | C=C1COC2(C(=O)OC)O[C@H](CCCCCCC)[C@@](C)(O[Si](CC)(CC)CC)[C@H](O[Si](CC)(CC)CC)C12 |
| InChI | InChI=1S/C30H58O6Si2/c1-11-18-19-20-21-22-25-29(9,36-38(15-5,16-6)17-7)27(35-37(12-2,13-3)14-4)26-24(8)23-33-30(26,34-25)28(31)32-10/h25-27H,8,11-23H2,1-7,9-10H3/t25-,26?,27-,29-,30?/m1/s1 |
| InChIKey | RMGULWHUWRYDGG-JTMBGQKHSA-N |
| XLogP | 7.99 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.96 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|