C17H26O3 — CID 102446642
methyl (3S,3aR)-3-heptyl-4-methylidene-1,3,3a,5-tetrahydrocyclopenta[c]furan-6-carboxylate (PubChem CID 102446642) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is methyl (3S,3aR)-3-heptyl-4-methylidene-1,3,3a,5-tetrahydrocyclopenta[c]furan-6-carboxylate.
| Compound Name | methyl (3S,3aR)-3-heptyl-4-methylidene-1,3,3a,5-tetrahydrocyclopenta[c]furan-6-carboxylate |
|---|---|
| PubChem CID | 102446642 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | methyl (3S,3aR)-3-heptyl-4-methylidene-1,3,3a,5-tetrahydrocyclopenta[c]furan-6-carboxylate |
| SMILES | C=C1CC(C(=O)OC)=C2CO[C@@H](CCCCCCC)[C@H]12 |
| InChI | InChI=1S/C17H26O3/c1-4-5-6-7-8-9-15-16-12(2)10-13(17(18)19-3)14(16)11-20-15/h15-16H,2,4-11H2,1,3H3/t15-,16+/m0/s1 |
| InChIKey | XFOYUEXWDUPMAI-JKSUJKDBSA-N |
| XLogP | 3.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|