C16H27NO5 — CID 15419790
methyl (1R,4S,5R,6S)-6-hexyl-5-methoxy-1,2-dimethyl-3-oxo-7-oxa-2-azabicyclo[2.2.1]heptane-4-carboxylate (PubChem CID 15419790) has the molecular formula C16H27NO5 and a molecular weight of 313.39 g/mol. Its IUPAC name is methyl (1R,4S,5R,6S)-6-hexyl-5-methoxy-1,2-dimethyl-3-oxo-7-oxa-2-azabicyclo[2.2.1]heptane-4-carboxylate.
| Compound Name | methyl (1R,4S,5R,6S)-6-hexyl-5-methoxy-1,2-dimethyl-3-oxo-7-oxa-2-azabicyclo[2.2.1]heptane-4-carboxylate |
|---|---|
| PubChem CID | 15419790 |
| Molecular Formula | C16H27NO5 |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | methyl (1R,4S,5R,6S)-6-hexyl-5-methoxy-1,2-dimethyl-3-oxo-7-oxa-2-azabicyclo[2.2.1]heptane-4-carboxylate |
| SMILES | CCCCCC[C@H]1[C@@H](OC)[C@]2(C(=O)OC)O[C@@]1(C)N(C)C2=O |
| InChI | InChI=1S/C16H27NO5/c1-6-7-8-9-10-11-12(20-4)16(14(19)21-5)13(18)17(3)15(11,2)22-16/h11-12H,6-10H2,1-5H3/t11-,12+,15+,16-/m0/s1 |
| InChIKey | MHYFNIVPZHXLBL-OJDYBEQGSA-N |
| XLogP | 1.72 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|