C16H25ClO4 — CID 10990735
methyl (3S,4R,5R)-3-chloro-4-ethenyl-5-octyl-2-oxooxolane-3-carboxylate (PubChem CID 10990735) has the molecular formula C16H25ClO4 and a molecular weight of 316.83 g/mol. Its IUPAC name is methyl (3S,4R,5R)-3-chloro-4-ethenyl-5-octyl-2-oxooxolane-3-carboxylate.
| Compound Name | methyl (3S,4R,5R)-3-chloro-4-ethenyl-5-octyl-2-oxooxolane-3-carboxylate |
|---|---|
| PubChem CID | 10990735 |
| Molecular Formula | C16H25ClO4 |
| Molecular Weight | 316.83 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | methyl (3S,4R,5R)-3-chloro-4-ethenyl-5-octyl-2-oxooxolane-3-carboxylate |
| SMILES | C=C[C@@H]1[C@@H](CCCCCCCC)OC(=O)[C@@]1(Cl)C(=O)OC |
| InChI | InChI=1S/C16H25ClO4/c1-4-6-7-8-9-10-11-13-12(5-2)16(17,14(18)20-3)15(19)21-13/h5,12-13H,2,4,6-11H2,1,3H3/t12-,13-,16+/m1/s1 |
| InChIKey | MEWPUGVJTAKUEA-IOASZLSFSA-N |
| XLogP | 3.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.83 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|