C17H26O7 — CID 21156111
trimethyl 5-hexyl-4-oxocyclopentane-1,1,3-tricarboxylate (PubChem CID 21156111) has the molecular formula C17H26O7 and a molecular weight of 342.39 g/mol. Its IUPAC name is trimethyl 5-hexyl-4-oxocyclopentane-1,1,3-tricarboxylate.
| Compound Name | trimethyl 5-hexyl-4-oxocyclopentane-1,1,3-tricarboxylate |
|---|---|
| PubChem CID | 21156111 |
| Molecular Formula | C17H26O7 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | trimethyl 5-hexyl-4-oxocyclopentane-1,1,3-tricarboxylate |
| SMILES | CCCCCCC1C(=O)C(C(=O)OC)CC1(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C17H26O7/c1-5-6-7-8-9-12-13(18)11(14(19)22-2)10-17(12,15(20)23-3)16(21)24-4/h11-12H,5-10H2,1-4H3 |
| InChIKey | GJPJKGDSKASGLS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|