C22H30O4 — CID 11121900
dimethyl 2-hexyl-3-(4-methylphenyl)cyclopent-3-ene-1,1-dicarboxylate (PubChem CID 11121900) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is dimethyl 2-hexyl-3-(4-methylphenyl)cyclopent-3-ene-1,1-dicarboxylate.
| Compound Name | dimethyl 2-hexyl-3-(4-methylphenyl)cyclopent-3-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 11121900 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | dimethyl 2-hexyl-3-(4-methylphenyl)cyclopent-3-ene-1,1-dicarboxylate |
| SMILES | CCCCCCC1C(c2ccc(C)cc2)=CCC1(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C22H30O4/c1-5-6-7-8-9-19-18(17-12-10-16(2)11-13-17)14-15-22(19,20(23)25-3)21(24)26-4/h10-14,19H,5-9,15H2,1-4H3 |
| InChIKey | VWBGZZDTPPIJOD-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|