C24H34O4 — CID 10407837
diethyl 3-methylidene-2-octyl-2H-indene-1,1-dicarboxylate (PubChem CID 10407837) has the molecular formula C24H34O4 and a molecular weight of 386.53 g/mol. Its IUPAC name is diethyl 3-methylidene-2-octyl-2H-indene-1,1-dicarboxylate.
| Compound Name | diethyl 3-methylidene-2-octyl-2H-indene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10407837 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | diethyl 3-methylidene-2-octyl-2H-indene-1,1-dicarboxylate |
| SMILES | C=C1c2ccccc2C(C(=O)OCC)(C(=O)OCC)C1CCCCCCCC |
| InChI | InChI=1S/C24H34O4/c1-5-8-9-10-11-12-16-20-18(4)19-15-13-14-17-21(19)24(20,22(25)27-6-2)23(26)28-7-3/h13-15,17,20H,4-12,16H2,1-3H3 |
| InChIKey | MEEBFXZWJRWDLR-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|