C17H19NO6 — CID 132501368
diethyl (1R)-3-methylidene-1-(nitromethyl)-1H-indene-2,2-dicarboxylate (PubChem CID 132501368) has the molecular formula C17H19NO6 and a molecular weight of 333.34 g/mol. Its IUPAC name is diethyl (1R)-3-methylidene-1-(nitromethyl)-1H-indene-2,2-dicarboxylate.
| Compound Name | diethyl (1R)-3-methylidene-1-(nitromethyl)-1H-indene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 132501368 |
| Molecular Formula | C17H19NO6 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | diethyl (1R)-3-methylidene-1-(nitromethyl)-1H-indene-2,2-dicarboxylate |
| SMILES | C=C1c2ccccc2[C@@H](C[N+](=O)[O-])C1(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C17H19NO6/c1-4-23-15(19)17(16(20)24-5-2)11(3)12-8-6-7-9-13(12)14(17)10-18(21)22/h6-9,14H,3-5,10H2,1-2H3/t14-/m1/s1 |
| InChIKey | IANGESSUDRJJBT-CQSZACIVSA-N |
| XLogP | 2.19 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|