C18H22BrNO6 — CID 140557368
ethyl (1R,2R,3S,4R)-1-acetyl-2-(2-bromophenyl)-4-hydroxy-4-methyl-3-nitrocyclohexane-1-carboxylate (PubChem CID 140557368) has the molecular formula C18H22BrNO6 and a molecular weight of 428.28 g/mol. Its IUPAC name is ethyl (1R,2R,3S,4R)-1-acetyl-2-(2-bromophenyl)-4-hydroxy-4-methyl-3-nitrocyclohexane-1-carboxylate.
| Compound Name | ethyl (1R,2R,3S,4R)-1-acetyl-2-(2-bromophenyl)-4-hydroxy-4-methyl-3-nitrocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 140557368 |
| Molecular Formula | C18H22BrNO6 |
| Molecular Weight | 428.28 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | ethyl (1R,2R,3S,4R)-1-acetyl-2-(2-bromophenyl)-4-hydroxy-4-methyl-3-nitrocyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(C(C)=O)CC[C@@](C)(O)[C@@H]([N+](=O)[O-])[C@H]1c1ccccc1Br |
| InChI | InChI=1S/C18H22BrNO6/c1-4-26-16(22)18(11(2)21)10-9-17(3,23)15(20(24)25)14(18)12-7-5-6-8-13(12)19/h5-8,14-15,23H,4,9-10H2,1-3H3/t14-,15+,17-,18+/m1/s1 |
| InChIKey | PGAMMBOFPAWJSB-ATLSCFEFSA-N |
| XLogP | 2.86 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|