C15H14FN3O3 — CID 45103079
(2R,3S,4R)-2-(4-fluorophenyl)-4-hydroxy-4-methyl-3-nitrocyclohexane-1,1-dicarbonitrile (PubChem CID 45103079) has the molecular formula C15H14FN3O3 and a molecular weight of 303.29 g/mol. Its IUPAC name is (2R,3S,4R)-2-(4-fluorophenyl)-4-hydroxy-4-methyl-3-nitrocyclohexane-1,1-dicarbonitrile.
| Compound Name | (2R,3S,4R)-2-(4-fluorophenyl)-4-hydroxy-4-methyl-3-nitrocyclohexane-1,1-dicarbonitrile |
|---|---|
| PubChem CID | 45103079 |
| Molecular Formula | C15H14FN3O3 |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | (2R,3S,4R)-2-(4-fluorophenyl)-4-hydroxy-4-methyl-3-nitrocyclohexane-1,1-dicarbonitrile |
| SMILES | C[C@@]1(O)CCC(C#N)(C#N)[C@@H](c2ccc(F)cc2)[C@@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C15H14FN3O3/c1-14(20)6-7-15(8-17,9-18)12(13(14)19(21)22)10-2-4-11(16)5-3-10/h2-5,12-13,20H,6-7H2,1H3/t12-,13-,14+/m0/s1 |
| InChIKey | UEXDOFIDRVUDFB-MELADBBJSA-N |
| XLogP | 2.13 |
| TPSA | 110.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|