C26H27FN2O3 — CID 175007690
ethyl 2-[5,5-dicyano-8-(4-fluorophenyl)-4-phenyloxonan-3-yl]acetate (PubChem CID 175007690) has the molecular formula C26H27FN2O3 and a molecular weight of 434.51 g/mol. Its IUPAC name is ethyl 2-[5,5-dicyano-8-(4-fluorophenyl)-4-phenyloxonan-3-yl]acetate.
| Compound Name | ethyl 2-[5,5-dicyano-8-(4-fluorophenyl)-4-phenyloxonan-3-yl]acetate |
|---|---|
| PubChem CID | 175007690 |
| Molecular Formula | C26H27FN2O3 |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | ethyl 2-[5,5-dicyano-8-(4-fluorophenyl)-4-phenyloxonan-3-yl]acetate |
| SMILES | CCOC(=O)CC1COCC(c2ccc(F)cc2)CCC(C#N)(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C26H27FN2O3/c1-2-32-24(30)14-22-16-31-15-21(19-8-10-23(27)11-9-19)12-13-26(17-28,18-29)25(22)20-6-4-3-5-7-20/h3-11,21-22,25H,2,12-16H2,1H3 |
| InChIKey | GDGCTAXSBHCEKE-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 83.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |